C22H34N2O2 — CID 113159574
2-[acetyl(cyclohexyl)amino]-N-[2,6-di(propan-2-yl)phenyl]acetamide (PubChem CID 113159574) has the molecular formula C22H34N2O2 and a molecular weight of 358.53 g/mol. Its IUPAC name is 2-[acetyl(cyclohexyl)amino]-N-[2,6-di(propan-2-yl)phenyl]acetamide.
| Compound Name | 2-[acetyl(cyclohexyl)amino]-N-[2,6-di(propan-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 113159574 |
| Molecular Formula | C22H34N2O2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.26 |
| IUPAC Name | 2-[acetyl(cyclohexyl)amino]-N-[2,6-di(propan-2-yl)phenyl]acetamide |
| SMILES | CC(=O)N(CC(=O)Nc1c(C(C)C)cccc1C(C)C)C1CCCCC1 |
| InChI | InChI=1S/C22H34N2O2/c1-15(2)19-12-9-13-20(16(3)4)22(19)23-21(26)14-24(17(5)25)18-10-7-6-8-11-18/h9,12-13,15-16,18H,6-8,10-11,14H2,1-5H3,(H,23,26) |
| InChIKey | CLGMOHGOODXIGH-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |