C19H29NO — CID 729635
N-[2,6-di(propan-2-yl)phenyl]cyclohexanecarboxamide (PubChem CID 729635) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]cyclohexanecarboxamide.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 729635 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]cyclohexanecarboxamide |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)C1CCCCC1 |
| InChI | InChI=1S/C19H29NO/c1-13(2)16-11-8-12-17(14(3)4)18(16)20-19(21)15-9-6-5-7-10-15/h8,11-15H,5-7,9-10H2,1-4H3,(H,20,21) |
| InChIKey | PPFGACYHTNLPBH-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |