C25H36N2O — CID 12058189
1,3-bis[2,6-di(propan-2-yl)phenyl]urea (PubChem CID 12058189) has the molecular formula C25H36N2O and a molecular weight of 380.58 g/mol. Its IUPAC name is 1,3-bis[2,6-di(propan-2-yl)phenyl]urea.
| Compound Name | 1,3-bis[2,6-di(propan-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 12058189 |
| Molecular Formula | C25H36N2O |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.28 |
| IUPAC Name | 1,3-bis[2,6-di(propan-2-yl)phenyl]urea |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)Nc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C25H36N2O/c1-15(2)19-11-9-12-20(16(3)4)23(19)26-25(28)27-24-21(17(5)6)13-10-14-22(24)18(7)8/h9-18H,1-8H3,(H2,26,27,28) |
| InChIKey | KFNSIVZZQXAZBI-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |