C13H20N2OS — CID 142150395
1-[2,6-di(propan-2-yl)phenyl]-3-sulfanylurea (PubChem CID 142150395) has the molecular formula C13H20N2OS and a molecular weight of 252.38 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-3-sulfanylurea.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-3-sulfanylurea |
|---|---|
| PubChem CID | 142150395 |
| Molecular Formula | C13H20N2OS |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-3-sulfanylurea |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)NS |
| InChI | InChI=1S/C13H20N2OS/c1-8(2)10-6-5-7-11(9(3)4)12(10)14-13(16)15-17/h5-9,17H,1-4H3,(H2,14,15,16) |
| InChIKey | UVAVXPLVXMVJHZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|