C16H24N2O3 — CID 162651561
methyl 2-[[2,6-di(propan-2-yl)phenyl]carbamoylamino]acetate (PubChem CID 162651561) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is methyl 2-[[2,6-di(propan-2-yl)phenyl]carbamoylamino]acetate.
| Compound Name | methyl 2-[[2,6-di(propan-2-yl)phenyl]carbamoylamino]acetate |
|---|---|
| PubChem CID | 162651561 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | methyl 2-[[2,6-di(propan-2-yl)phenyl]carbamoylamino]acetate |
| SMILES | COC(=O)CNC(=O)Nc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C16H24N2O3/c1-10(2)12-7-6-8-13(11(3)4)15(12)18-16(20)17-9-14(19)21-5/h6-8,10-11H,9H2,1-5H3,(H2,17,18,20) |
| InChIKey | WTBWBAOTHAAHIP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |