C19H30N2O2 — CID 111103405
1-[2,6-di(propan-2-yl)phenyl]-3-[(1-hydroxycyclopentyl)methyl]urea (PubChem CID 111103405) has the molecular formula C19H30N2O2 and a molecular weight of 318.46 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-3-[(1-hydroxycyclopentyl)methyl]urea.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-3-[(1-hydroxycyclopentyl)methyl]urea |
|---|---|
| PubChem CID | 111103405 |
| Molecular Formula | C19H30N2O2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-3-[(1-hydroxycyclopentyl)methyl]urea |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)NCC1(O)CCCC1 |
| InChI | InChI=1S/C19H30N2O2/c1-13(2)15-8-7-9-16(14(3)4)17(15)21-18(22)20-12-19(23)10-5-6-11-19/h7-9,13-14,23H,5-6,10-12H2,1-4H3,(H2,20,21,22) |
| InChIKey | CHNLXSNSQYRMKQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |