C17H28N2O — CID 3588413
1-[2,6-di(propan-2-yl)phenyl]-3-(2-methylpropyl)urea (PubChem CID 3588413) has the molecular formula C17H28N2O and a molecular weight of 276.42 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-3-(2-methylpropyl)urea.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-3-(2-methylpropyl)urea |
|---|---|
| PubChem CID | 3588413 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-3-(2-methylpropyl)urea |
| SMILES | CC(C)CNC(=O)Nc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C17H28N2O/c1-11(2)10-18-17(20)19-16-14(12(3)4)8-7-9-15(16)13(5)6/h7-9,11-13H,10H2,1-6H3,(H2,18,19,20) |
| InChIKey | DSGXTJPCCVFOFC-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |