C21H29N3O — CID 67941886
1-[(2S)-2-amino-2-phenylethyl]-3-[2,6-di(propan-2-yl)phenyl]urea (PubChem CID 67941886) has the molecular formula C21H29N3O and a molecular weight of 339.48 g/mol. Its IUPAC name is 1-[(2S)-2-amino-2-phenylethyl]-3-[2,6-di(propan-2-yl)phenyl]urea.
| Compound Name | 1-[(2S)-2-amino-2-phenylethyl]-3-[2,6-di(propan-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 67941886 |
| Molecular Formula | C21H29N3O |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | 1-[(2S)-2-amino-2-phenylethyl]-3-[2,6-di(propan-2-yl)phenyl]urea |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)NC[C@@H](N)c1ccccc1 |
| InChI | InChI=1S/C21H29N3O/c1-14(2)17-11-8-12-18(15(3)4)20(17)24-21(25)23-13-19(22)16-9-6-5-7-10-16/h5-12,14-15,19H,13,22H2,1-4H3,(H2,23,24,25)/t19-/m1/s1 |
| InChIKey | BBHANMKBXKVDES-LJQANCHMSA-N |
| XLogP | 4.75 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |