C26H31N3O2 — CID 10409738
1-[2,6-di(propan-2-yl)phenyl]-3-[(2R)-2-(furan-3-ylmethylideneamino)-2-phenylethyl]urea (PubChem CID 10409738) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-3-[(2R)-2-(furan-3-ylmethylideneamino)-2-phenylethyl]urea.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-3-[(2R)-2-(furan-3-ylmethylideneamino)-2-phenylethyl]urea |
|---|---|
| PubChem CID | 10409738 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-3-[(2R)-2-(furan-3-ylmethylideneamino)-2-phenylethyl]urea |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)NC[C@H](/N=C/c1ccoc1)c1ccccc1 |
| InChI | InChI=1S/C26H31N3O2/c1-18(2)22-11-8-12-23(19(3)4)25(22)29-26(30)28-16-24(21-9-6-5-7-10-21)27-15-20-13-14-31-17-20/h5-15,17-19,24H,16H2,1-4H3,(H2,28,29,30)/b27-15+/t24-/m0/s1 |
| InChIKey | XMHCSFGOTXGXOL-SJUCLPJRSA-N |
| XLogP | 6.51 |
| TPSA | 66.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|