C30H38FN3O2 — CID 142640409
1-[2,6-di(propan-2-yl)phenyl]-3-[2-[1-[(4-fluorophenyl)methoxy]ethylamino]-2-phenylethyl]urea (PubChem CID 142640409) has the molecular formula C30H38FN3O2 and a molecular weight of 491.65 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-3-[2-[1-[(4-fluorophenyl)methoxy]ethylamino]-2-phenylethyl]urea.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-3-[2-[1-[(4-fluorophenyl)methoxy]ethylamino]-2-phenylethyl]urea |
|---|---|
| PubChem CID | 142640409 |
| Molecular Formula | C30H38FN3O2 |
| Molecular Weight | 491.65 g/mol |
| Exact Mass | 491.29 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-3-[2-[1-[(4-fluorophenyl)methoxy]ethylamino]-2-phenylethyl]urea |
| SMILES | CC(NC(CNC(=O)Nc1c(C(C)C)cccc1C(C)C)c1ccccc1)OCc1ccc(F)cc1 |
| InChI | InChI=1S/C30H38FN3O2/c1-20(2)26-12-9-13-27(21(3)4)29(26)34-30(35)32-18-28(24-10-7-6-8-11-24)33-22(5)36-19-23-14-16-25(31)17-15-23/h6-17,20-22,28,33H,18-19H2,1-5H3,(H2,32,34,35) |
| InChIKey | QKXYKVRZRVYNLE-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.65 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|