C28H34N4O3 — CID 10412628
1-[2,6-di(propan-2-yl)phenyl]-3-[(2R)-2-[(3-nitrophenyl)methylamino]-2-phenylethyl]urea (PubChem CID 10412628) has the molecular formula C28H34N4O3 and a molecular weight of 474.61 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-3-[(2R)-2-[(3-nitrophenyl)methylamino]-2-phenylethyl]urea.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-3-[(2R)-2-[(3-nitrophenyl)methylamino]-2-phenylethyl]urea |
|---|---|
| PubChem CID | 10412628 |
| Molecular Formula | C28H34N4O3 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-3-[(2R)-2-[(3-nitrophenyl)methylamino]-2-phenylethyl]urea |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)NC[C@H](NCc1cccc([N+](=O)[O-])c1)c1ccccc1 |
| InChI | InChI=1S/C28H34N4O3/c1-19(2)24-14-9-15-25(20(3)4)27(24)31-28(33)30-18-26(22-11-6-5-7-12-22)29-17-21-10-8-13-23(16-21)32(34)35/h5-16,19-20,26,29H,17-18H2,1-4H3,(H2,30,31,33)/t26-/m0/s1 |
| InChIKey | REPLDDGMOISVCL-SANMLTNESA-N |
| XLogP | 6.49 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|