C28H35N3O2 — CID 142628200
1-[2,6-di(propan-2-yl)phenyl]-3-[2-phenyl-2-(phenylmethoxyamino)ethyl]urea (PubChem CID 142628200) has the molecular formula C28H35N3O2 and a molecular weight of 445.61 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-3-[2-phenyl-2-(phenylmethoxyamino)ethyl]urea.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-3-[2-phenyl-2-(phenylmethoxyamino)ethyl]urea |
|---|---|
| PubChem CID | 142628200 |
| Molecular Formula | C28H35N3O2 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-3-[2-phenyl-2-(phenylmethoxyamino)ethyl]urea |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)NCC(NOCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H35N3O2/c1-20(2)24-16-11-17-25(21(3)4)27(24)30-28(32)29-18-26(23-14-9-6-10-15-23)31-33-19-22-12-7-5-8-13-22/h5-17,20-21,26,31H,18-19H2,1-4H3,(H2,29,30,32) |
| InChIKey | GFTUJBINDZIXBC-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|