C29H35N3O2 — CID 10321884
1-[2,6-di(propan-2-yl)phenyl]-3-[(2R)-2-[(2-methoxyphenyl)methylideneamino]-2-phenylethyl]urea (PubChem CID 10321884) has the molecular formula C29H35N3O2 and a molecular weight of 457.62 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-3-[(2R)-2-[(2-methoxyphenyl)methylideneamino]-2-phenylethyl]urea.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-3-[(2R)-2-[(2-methoxyphenyl)methylideneamino]-2-phenylethyl]urea |
|---|---|
| PubChem CID | 10321884 |
| Molecular Formula | C29H35N3O2 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.27 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-3-[(2R)-2-[(2-methoxyphenyl)methylideneamino]-2-phenylethyl]urea |
| SMILES | COc1ccccc1/C=N/[C@@H](CNC(=O)Nc1c(C(C)C)cccc1C(C)C)c1ccccc1 |
| InChI | InChI=1S/C29H35N3O2/c1-20(2)24-15-11-16-25(21(3)4)28(24)32-29(33)31-19-26(22-12-7-6-8-13-22)30-18-23-14-9-10-17-27(23)34-5/h6-18,20-21,26H,19H2,1-5H3,(H2,31,32,33)/b30-18+/t26-/m0/s1 |
| InChIKey | VMOJLWJUEWVNST-TWKIEXGSSA-N |
| XLogP | 6.92 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|