C35H38N2O3 — CID 19874995
N-benzhydryl-N-[2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl]-2-methoxybenzamide (PubChem CID 19874995) has the molecular formula C35H38N2O3 and a molecular weight of 534.70 g/mol. Its IUPAC name is N-benzhydryl-N-[2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl]-2-methoxybenzamide.
| Compound Name | N-benzhydryl-N-[2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 19874995 |
| Molecular Formula | C35H38N2O3 |
| Molecular Weight | 534.70 g/mol |
| Exact Mass | 534.29 |
| IUPAC Name | N-benzhydryl-N-[2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)N(CC(=O)Nc1c(C(C)C)cccc1C(C)C)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H38N2O3/c1-24(2)28-20-14-21-29(25(3)4)33(28)36-32(38)23-37(35(39)30-19-12-13-22-31(30)40-5)34(26-15-8-6-9-16-26)27-17-10-7-11-18-27/h6-22,24-25,34H,23H2,1-5H3,(H,36,38) |
| InChIKey | FFIUNKQHIXEEDQ-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.70 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |