C20H34N2O3 — CID 33483708
2-[bis(2-methoxyethyl)amino]-N-[2,6-di(propan-2-yl)phenyl]acetamide (PubChem CID 33483708) has the molecular formula C20H34N2O3 and a molecular weight of 350.50 g/mol. Its IUPAC name is 2-[bis(2-methoxyethyl)amino]-N-[2,6-di(propan-2-yl)phenyl]acetamide.
| Compound Name | 2-[bis(2-methoxyethyl)amino]-N-[2,6-di(propan-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 33483708 |
| Molecular Formula | C20H34N2O3 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | 2-[bis(2-methoxyethyl)amino]-N-[2,6-di(propan-2-yl)phenyl]acetamide |
| SMILES | COCCN(CCOC)CC(=O)Nc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C20H34N2O3/c1-15(2)17-8-7-9-18(16(3)4)20(17)21-19(23)14-22(10-12-24-5)11-13-25-6/h7-9,15-16H,10-14H2,1-6H3,(H,21,23) |
| InChIKey | VLUVCEJWGRWWEX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |