C12H18N2O4 — CID 108867914
1-(2,6-dimethoxyphenyl)-3-(2-hydroxypropyl)urea (PubChem CID 108867914) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is 1-(2,6-dimethoxyphenyl)-3-(2-hydroxypropyl)urea.
| Compound Name | 1-(2,6-dimethoxyphenyl)-3-(2-hydroxypropyl)urea |
|---|---|
| PubChem CID | 108867914 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 1-(2,6-dimethoxyphenyl)-3-(2-hydroxypropyl)urea |
| SMILES | COc1cccc(OC)c1NC(=O)NCC(C)O |
| InChI | InChI=1S/C12H18N2O4/c1-8(15)7-13-12(16)14-11-9(17-2)5-4-6-10(11)18-3/h4-6,8,15H,7H2,1-3H3,(H2,13,14,16) |
| InChIKey | NMFDRILSHGQXIW-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |