C13H20N2O3 — CID 108867821
1-tert-butyl-3-(2,6-dimethoxyphenyl)urea (PubChem CID 108867821) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is 1-tert-butyl-3-(2,6-dimethoxyphenyl)urea.
| Compound Name | 1-tert-butyl-3-(2,6-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 108867821 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 1-tert-butyl-3-(2,6-dimethoxyphenyl)urea |
| SMILES | COc1cccc(OC)c1NC(=O)NC(C)(C)C |
| InChI | InChI=1S/C13H20N2O3/c1-13(2,3)15-12(16)14-11-9(17-4)7-6-8-10(11)18-5/h6-8H,1-5H3,(H2,14,15,16) |
| InChIKey | BZJMLUZARGMGHU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |