C17H28N4O2 — CID 58918478
1-tert-butyl-3-[3-(tert-butylcarbamoylamino)-2-methylphenyl]urea (PubChem CID 58918478) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 1-tert-butyl-3-[3-(tert-butylcarbamoylamino)-2-methylphenyl]urea.
| Compound Name | 1-tert-butyl-3-[3-(tert-butylcarbamoylamino)-2-methylphenyl]urea |
|---|---|
| PubChem CID | 58918478 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 1-tert-butyl-3-[3-(tert-butylcarbamoylamino)-2-methylphenyl]urea |
| SMILES | Cc1c(NC(=O)NC(C)(C)C)cccc1NC(=O)NC(C)(C)C |
| InChI | InChI=1S/C17H28N4O2/c1-11-12(18-14(22)20-16(2,3)4)9-8-10-13(11)19-15(23)21-17(5,6)7/h8-10H,1-7H3,(H2,18,20,22)(H2,19,21,23) |
| InChIKey | RJYAFQILJMTYHH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |