C14H22N2O2 — CID 111754138
1-(2,3-dimethylphenyl)-3-(4-hydroxy-2-methylbutan-2-yl)urea (PubChem CID 111754138) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-3-(4-hydroxy-2-methylbutan-2-yl)urea.
| Compound Name | 1-(2,3-dimethylphenyl)-3-(4-hydroxy-2-methylbutan-2-yl)urea |
|---|---|
| PubChem CID | 111754138 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-3-(4-hydroxy-2-methylbutan-2-yl)urea |
| SMILES | Cc1cccc(NC(=O)NC(C)(C)CCO)c1C |
| InChI | InChI=1S/C14H22N2O2/c1-10-6-5-7-12(11(10)2)15-13(18)16-14(3,4)8-9-17/h5-7,17H,8-9H2,1-4H3,(H2,15,16,18) |
| InChIKey | RSPMXIBOWJUOBM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |