C21H36N4O2 — CID 58918481
1-tert-butyl-3-[3-(2-ethylhexylcarbamoylamino)-2-methylphenyl]urea (PubChem CID 58918481) has the molecular formula C21H36N4O2 and a molecular weight of 376.55 g/mol. Its IUPAC name is 1-tert-butyl-3-[3-(2-ethylhexylcarbamoylamino)-2-methylphenyl]urea.
| Compound Name | 1-tert-butyl-3-[3-(2-ethylhexylcarbamoylamino)-2-methylphenyl]urea |
|---|---|
| PubChem CID | 58918481 |
| Molecular Formula | C21H36N4O2 |
| Molecular Weight | 376.55 g/mol |
| Exact Mass | 376.28 |
| IUPAC Name | 1-tert-butyl-3-[3-(2-ethylhexylcarbamoylamino)-2-methylphenyl]urea |
| SMILES | CCCCC(CC)CNC(=O)Nc1cccc(NC(=O)NC(C)(C)C)c1C |
| InChI | InChI=1S/C21H36N4O2/c1-7-9-11-16(8-2)14-22-19(26)23-17-12-10-13-18(15(17)3)24-20(27)25-21(4,5)6/h10,12-13,16H,7-9,11,14H2,1-6H3,(H2,22,23,26)(H2,24,25,27) |
| InChIKey | WUURXMHHACUTEF-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.55 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |