C25H44N4O2 — CID 101499424
1-[(2R)-2-ethylhexyl]-3-[3-[[(2R)-2-ethylhexyl]carbamoylamino]-4-methylphenyl]urea (PubChem CID 101499424) has the molecular formula C25H44N4O2 and a molecular weight of 432.65 g/mol. Its IUPAC name is 1-[(2R)-2-ethylhexyl]-3-[3-[[(2R)-2-ethylhexyl]carbamoylamino]-4-methylphenyl]urea.
| Compound Name | 1-[(2R)-2-ethylhexyl]-3-[3-[[(2R)-2-ethylhexyl]carbamoylamino]-4-methylphenyl]urea |
|---|---|
| PubChem CID | 101499424 |
| Molecular Formula | C25H44N4O2 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.35 |
| IUPAC Name | 1-[(2R)-2-ethylhexyl]-3-[3-[[(2R)-2-ethylhexyl]carbamoylamino]-4-methylphenyl]urea |
| SMILES | CCCCC(CC)CNC(=O)Nc1cc(NC(=O)NC[C@H](CC)CCCC)ccc1C |
| InChI | InChI=1S/C25H44N4O2/c1-6-10-12-20(8-3)17-26-24(30)28-22-15-14-19(5)23(16-22)29-25(31)27-18-21(9-4)13-11-7-2/h14-16,20-21H,6-13,17-18H2,1-5H3,(H2,26,28,30)(H2,27,29,31)/t20-,21?/m1/s1 |
| InChIKey | XRHQNEHFSQNYKI-VQCQRNETSA-N |
| XLogP | 6.67 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |