C23H38N4O3 — CID 89220522
1-[3-(2-ethylhexoxy)propyl]-3-[2-methyl-5-(prop-1-en-2-ylcarbamoylamino)phenyl]urea (PubChem CID 89220522) has the molecular formula C23H38N4O3 and a molecular weight of 418.58 g/mol. Its IUPAC name is 1-[3-(2-ethylhexoxy)propyl]-3-[2-methyl-5-(prop-1-en-2-ylcarbamoylamino)phenyl]urea.
| Compound Name | 1-[3-(2-ethylhexoxy)propyl]-3-[2-methyl-5-(prop-1-en-2-ylcarbamoylamino)phenyl]urea |
|---|---|
| PubChem CID | 89220522 |
| Molecular Formula | C23H38N4O3 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | 1-[3-(2-ethylhexoxy)propyl]-3-[2-methyl-5-(prop-1-en-2-ylcarbamoylamino)phenyl]urea |
| SMILES | C=C(C)NC(=O)Nc1ccc(C)c(NC(=O)NCCCOCC(CC)CCCC)c1 |
| InChI | InChI=1S/C23H38N4O3/c1-6-8-10-19(7-2)16-30-14-9-13-24-22(28)27-21-15-20(12-11-18(21)5)26-23(29)25-17(3)4/h11-12,15,19H,3,6-10,13-14,16H2,1-2,4-5H3,(H2,24,27,28)(H2,25,26,29) |
| InChIKey | QXPOFGCSWRDPBC-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|