C18H28F2N2O2 — CID 3671941
1-(2,6-difluorophenyl)-3-[3-(2-ethylhexoxy)propyl]urea (PubChem CID 3671941) has the molecular formula C18H28F2N2O2 and a molecular weight of 342.43 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-3-[3-(2-ethylhexoxy)propyl]urea.
| Compound Name | 1-(2,6-difluorophenyl)-3-[3-(2-ethylhexoxy)propyl]urea |
|---|---|
| PubChem CID | 3671941 |
| Molecular Formula | C18H28F2N2O2 |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 1-(2,6-difluorophenyl)-3-[3-(2-ethylhexoxy)propyl]urea |
| SMILES | CCCCC(CC)COCCCNC(=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C18H28F2N2O2/c1-3-5-8-14(4-2)13-24-12-7-11-21-18(23)22-17-15(19)9-6-10-16(17)20/h6,9-10,14H,3-5,7-8,11-13H2,1-2H3,(H2,21,22,23) |
| InChIKey | WGDPYMHILPOEFT-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|