C13H16F2N2O3 — CID 47225872
N'-(2,6-difluorophenyl)-N-(3-ethoxypropyl)oxamide (PubChem CID 47225872) has the molecular formula C13H16F2N2O3 and a molecular weight of 286.28 g/mol. Its IUPAC name is N'-(2,6-difluorophenyl)-N-(3-ethoxypropyl)oxamide.
| Compound Name | N'-(2,6-difluorophenyl)-N-(3-ethoxypropyl)oxamide |
|---|---|
| PubChem CID | 47225872 |
| Molecular Formula | C13H16F2N2O3 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | N'-(2,6-difluorophenyl)-N-(3-ethoxypropyl)oxamide |
| SMILES | CCOCCCNC(=O)C(=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C13H16F2N2O3/c1-2-20-8-4-7-16-12(18)13(19)17-11-9(14)5-3-6-10(11)15/h3,5-6H,2,4,7-8H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | WMCRETAZQQQUOG-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|