C11H11ClF2N2O2 — CID 108513680
N-(3-chloropropyl)-N'-(2,6-difluorophenyl)oxamide (PubChem CID 108513680) has the molecular formula C11H11ClF2N2O2 and a molecular weight of 276.67 g/mol. Its IUPAC name is N-(3-chloropropyl)-N'-(2,6-difluorophenyl)oxamide.
| Compound Name | N-(3-chloropropyl)-N'-(2,6-difluorophenyl)oxamide |
|---|---|
| PubChem CID | 108513680 |
| Molecular Formula | C11H11ClF2N2O2 |
| Molecular Weight | 276.67 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | N-(3-chloropropyl)-N'-(2,6-difluorophenyl)oxamide |
| SMILES | O=C(NCCCCl)C(=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C11H11ClF2N2O2/c12-5-2-6-15-10(17)11(18)16-9-7(13)3-1-4-8(9)14/h1,3-4H,2,5-6H2,(H,15,17)(H,16,18) |
| InChIKey | NKMPCUBLPMROSU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.67 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|