C15H20F2N2O3 — CID 111490747
N'-(2,6-difluorophenyl)-N-(4-hydroxy-2,2-dimethylpentyl)oxamide (PubChem CID 111490747) has the molecular formula C15H20F2N2O3 and a molecular weight of 314.33 g/mol. Its IUPAC name is N'-(2,6-difluorophenyl)-N-(4-hydroxy-2,2-dimethylpentyl)oxamide.
| Compound Name | N'-(2,6-difluorophenyl)-N-(4-hydroxy-2,2-dimethylpentyl)oxamide |
|---|---|
| PubChem CID | 111490747 |
| Molecular Formula | C15H20F2N2O3 |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | N'-(2,6-difluorophenyl)-N-(4-hydroxy-2,2-dimethylpentyl)oxamide |
| SMILES | CC(O)CC(C)(C)CNC(=O)C(=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C15H20F2N2O3/c1-9(20)7-15(2,3)8-18-13(21)14(22)19-12-10(16)5-4-6-11(12)17/h4-6,9,20H,7-8H2,1-3H3,(H,18,21)(H,19,22) |
| InChIKey | VLWGWCQEROEQEK-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|