C14H19F3N2O2 — CID 111475074
1-(4-hydroxy-2,2-dimethylpentyl)-3-(3,4,5-trifluorophenyl)urea (PubChem CID 111475074) has the molecular formula C14H19F3N2O2 and a molecular weight of 304.31 g/mol. Its IUPAC name is 1-(4-hydroxy-2,2-dimethylpentyl)-3-(3,4,5-trifluorophenyl)urea.
| Compound Name | 1-(4-hydroxy-2,2-dimethylpentyl)-3-(3,4,5-trifluorophenyl)urea |
|---|---|
| PubChem CID | 111475074 |
| Molecular Formula | C14H19F3N2O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 1-(4-hydroxy-2,2-dimethylpentyl)-3-(3,4,5-trifluorophenyl)urea |
| SMILES | CC(O)CC(C)(C)CNC(=O)Nc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C14H19F3N2O2/c1-8(20)6-14(2,3)7-18-13(21)19-9-4-10(15)12(17)11(16)5-9/h4-5,8,20H,6-7H2,1-3H3,(H2,18,19,21) |
| InChIKey | DTTWBKCBYAJGGX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|