C15H21F3N2O2 — CID 111472761
1-(4-hydroxy-2,2-dimethylpentyl)-3-[2-(trifluoromethyl)phenyl]urea (PubChem CID 111472761) has the molecular formula C15H21F3N2O2 and a molecular weight of 318.34 g/mol. Its IUPAC name is 1-(4-hydroxy-2,2-dimethylpentyl)-3-[2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(4-hydroxy-2,2-dimethylpentyl)-3-[2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 111472761 |
| Molecular Formula | C15H21F3N2O2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 1-(4-hydroxy-2,2-dimethylpentyl)-3-[2-(trifluoromethyl)phenyl]urea |
| SMILES | CC(O)CC(C)(C)CNC(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H21F3N2O2/c1-10(21)8-14(2,3)9-19-13(22)20-12-7-5-4-6-11(12)15(16,17)18/h4-7,10,21H,8-9H2,1-3H3,(H2,19,20,22) |
| InChIKey | IGNNHFJFDNVVEJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |