C18H30N2O3 — CID 111473925
1-(4-hydroxy-2,2-dimethylpentyl)-3-[2-(2-methylpropoxy)phenyl]urea (PubChem CID 111473925) has the molecular formula C18H30N2O3 and a molecular weight of 322.45 g/mol. Its IUPAC name is 1-(4-hydroxy-2,2-dimethylpentyl)-3-[2-(2-methylpropoxy)phenyl]urea.
| Compound Name | 1-(4-hydroxy-2,2-dimethylpentyl)-3-[2-(2-methylpropoxy)phenyl]urea |
|---|---|
| PubChem CID | 111473925 |
| Molecular Formula | C18H30N2O3 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | 1-(4-hydroxy-2,2-dimethylpentyl)-3-[2-(2-methylpropoxy)phenyl]urea |
| SMILES | CC(C)COc1ccccc1NC(=O)NCC(C)(C)CC(C)O |
| InChI | InChI=1S/C18H30N2O3/c1-13(2)11-23-16-9-7-6-8-15(16)20-17(22)19-12-18(4,5)10-14(3)21/h6-9,13-14,21H,10-12H2,1-5H3,(H2,19,20,22) |
| InChIKey | VGUYOUBDNFLIRI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |