C15H22F2N2O3 — CID 111473215
1-[2-(difluoromethoxy)phenyl]-3-(4-hydroxy-2,2-dimethylpentyl)urea (PubChem CID 111473215) has the molecular formula C15H22F2N2O3 and a molecular weight of 316.35 g/mol. Its IUPAC name is 1-[2-(difluoromethoxy)phenyl]-3-(4-hydroxy-2,2-dimethylpentyl)urea.
| Compound Name | 1-[2-(difluoromethoxy)phenyl]-3-(4-hydroxy-2,2-dimethylpentyl)urea |
|---|---|
| PubChem CID | 111473215 |
| Molecular Formula | C15H22F2N2O3 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 1-[2-(difluoromethoxy)phenyl]-3-(4-hydroxy-2,2-dimethylpentyl)urea |
| SMILES | CC(O)CC(C)(C)CNC(=O)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C15H22F2N2O3/c1-10(20)8-15(2,3)9-18-14(21)19-11-6-4-5-7-12(11)22-13(16)17/h4-7,10,13,20H,8-9H2,1-3H3,(H2,18,19,21) |
| InChIKey | HRENTFZPANTYIE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |