C15H16F2N2O3S — CID 111442981
1-[2-(difluoromethoxy)phenyl]-3-(2-hydroxy-2-thiophen-2-ylpropyl)urea (PubChem CID 111442981) has the molecular formula C15H16F2N2O3S and a molecular weight of 342.37 g/mol. Its IUPAC name is 1-[2-(difluoromethoxy)phenyl]-3-(2-hydroxy-2-thiophen-2-ylpropyl)urea.
| Compound Name | 1-[2-(difluoromethoxy)phenyl]-3-(2-hydroxy-2-thiophen-2-ylpropyl)urea |
|---|---|
| PubChem CID | 111442981 |
| Molecular Formula | C15H16F2N2O3S |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 1-[2-(difluoromethoxy)phenyl]-3-(2-hydroxy-2-thiophen-2-ylpropyl)urea |
| SMILES | CC(O)(CNC(=O)Nc1ccccc1OC(F)F)c1cccs1 |
| InChI | InChI=1S/C15H16F2N2O3S/c1-15(21,12-7-4-8-23-12)9-18-14(20)19-10-5-2-3-6-11(10)22-13(16)17/h2-8,13,21H,9H2,1H3,(H2,18,19,20) |
| InChIKey | PRCMQVQWRJQVIS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |