C11H11ClF2N2O3 — CID 43329114
2-chloro-N-[[2-(difluoromethoxy)phenyl]carbamoyl]propanamide (PubChem CID 43329114) has the molecular formula C11H11ClF2N2O3 and a molecular weight of 292.67 g/mol. Its IUPAC name is 2-chloro-N-[[2-(difluoromethoxy)phenyl]carbamoyl]propanamide.
| Compound Name | 2-chloro-N-[[2-(difluoromethoxy)phenyl]carbamoyl]propanamide |
|---|---|
| PubChem CID | 43329114 |
| Molecular Formula | C11H11ClF2N2O3 |
| Molecular Weight | 292.67 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 2-chloro-N-[[2-(difluoromethoxy)phenyl]carbamoyl]propanamide |
| SMILES | CC(Cl)C(=O)NC(=O)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C11H11ClF2N2O3/c1-6(12)9(17)16-11(18)15-7-4-2-3-5-8(7)19-10(13)14/h2-6,10H,1H3,(H2,15,16,17,18) |
| InChIKey | IOIHIXJVRDWEGN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.67 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|