C12H11Cl2F2NO2 — CID 47135412
2,2-dichloro-N-[2-(difluoromethoxy)phenyl]-1-methylcyclopropane-1-carboxamide (PubChem CID 47135412) has the molecular formula C12H11Cl2F2NO2 and a molecular weight of 310.13 g/mol. Its IUPAC name is 2,2-dichloro-N-[2-(difluoromethoxy)phenyl]-1-methylcyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-[2-(difluoromethoxy)phenyl]-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 47135412 |
| Molecular Formula | C12H11Cl2F2NO2 |
| Molecular Weight | 310.13 g/mol |
| Exact Mass | 309.01 |
| IUPAC Name | 2,2-dichloro-N-[2-(difluoromethoxy)phenyl]-1-methylcyclopropane-1-carboxamide |
| SMILES | CC1(C(=O)Nc2ccccc2OC(F)F)CC1(Cl)Cl |
| InChI | InChI=1S/C12H11Cl2F2NO2/c1-11(6-12(11,13)14)9(18)17-7-4-2-3-5-8(7)19-10(15)16/h2-5,10H,6H2,1H3,(H,17,18) |
| InChIKey | PTBPNUWZDSAUEX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.13 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|