C13H13Cl2F2NO3 — CID 46552870
2,2-dichloro-N-[3-(difluoromethoxy)-4-methoxyphenyl]-1-methylcyclopropane-1-carboxamide (PubChem CID 46552870) has the molecular formula C13H13Cl2F2NO3 and a molecular weight of 340.15 g/mol. Its IUPAC name is 2,2-dichloro-N-[3-(difluoromethoxy)-4-methoxyphenyl]-1-methylcyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-[3-(difluoromethoxy)-4-methoxyphenyl]-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 46552870 |
| Molecular Formula | C13H13Cl2F2NO3 |
| Molecular Weight | 340.15 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | 2,2-dichloro-N-[3-(difluoromethoxy)-4-methoxyphenyl]-1-methylcyclopropane-1-carboxamide |
| SMILES | COc1ccc(NC(=O)C2(C)CC2(Cl)Cl)cc1OC(F)F |
| InChI | InChI=1S/C13H13Cl2F2NO3/c1-12(6-13(12,14)15)10(19)18-7-3-4-8(20-2)9(5-7)21-11(16)17/h3-5,11H,6H2,1-2H3,(H,18,19) |
| InChIKey | XDJICFZWSPEWTA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.15 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|