C15H19Cl2NO3 — CID 43009787
2,2-dichloro-N-(3,4-diethoxyphenyl)-1-methylcyclopropane-1-carboxamide (PubChem CID 43009787) has the molecular formula C15H19Cl2NO3 and a molecular weight of 332.23 g/mol. Its IUPAC name is 2,2-dichloro-N-(3,4-diethoxyphenyl)-1-methylcyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-(3,4-diethoxyphenyl)-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 43009787 |
| Molecular Formula | C15H19Cl2NO3 |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 2,2-dichloro-N-(3,4-diethoxyphenyl)-1-methylcyclopropane-1-carboxamide |
| SMILES | CCOc1ccc(NC(=O)C2(C)CC2(Cl)Cl)cc1OCC |
| InChI | InChI=1S/C15H19Cl2NO3/c1-4-20-11-7-6-10(8-12(11)21-5-2)18-13(19)14(3)9-15(14,16)17/h6-8H,4-5,9H2,1-3H3,(H,18,19) |
| InChIKey | LNBLVAWVOANAMZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|