C13H17NO3 — CID 43616319
N-(3,4-diethoxyphenyl)prop-2-enamide (PubChem CID 43616319) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is N-(3,4-diethoxyphenyl)prop-2-enamide.
| Compound Name | N-(3,4-diethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 43616319 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | N-(3,4-diethoxyphenyl)prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(OCC)c(OCC)c1 |
| InChI | InChI=1S/C13H17NO3/c1-4-13(15)14-10-7-8-11(16-5-2)12(9-10)17-6-3/h4,7-9H,1,5-6H2,2-3H3,(H,14,15) |
| InChIKey | BQCCKHSMYKYFBI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|