C13H21N2O3+ — CID 2452185
[2-(3,4-diethoxyanilino)-2-oxoethyl]-methylazanium (PubChem CID 2452185) has the molecular formula C13H21N2O3+ and a molecular weight of 253.32 g/mol. Its IUPAC name is [2-(3,4-diethoxyanilino)-2-oxoethyl]-methylazanium.
| Compound Name | [2-(3,4-diethoxyanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 2452185 |
| Molecular Formula | C13H21N2O3+ |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | [2-(3,4-diethoxyanilino)-2-oxoethyl]-methylazanium |
| SMILES | CCOc1ccc(NC(=O)C[NH2+]C)cc1OCC |
| InChI | InChI=1S/C13H20N2O3/c1-4-17-11-7-6-10(8-12(11)18-5-2)15-13(16)9-14-3/h6-8,14H,4-5,9H2,1-3H3,(H,15,16)/p+1 |
| InChIKey | BYEPBHRSIJSTCE-UHFFFAOYSA-O |
| XLogP | 0.62 |
| TPSA | 64.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |