C12H17NO3S — CID 60650095
N-(3,4-diethoxyphenyl)-2-sulfanylacetamide (PubChem CID 60650095) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is N-(3,4-diethoxyphenyl)-2-sulfanylacetamide.
| Compound Name | N-(3,4-diethoxyphenyl)-2-sulfanylacetamide |
|---|---|
| PubChem CID | 60650095 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | N-(3,4-diethoxyphenyl)-2-sulfanylacetamide |
| SMILES | CCOc1ccc(NC(=O)CS)cc1OCC |
| InChI | InChI=1S/C12H17NO3S/c1-3-15-10-6-5-9(13-12(14)8-17)7-11(10)16-4-2/h5-7,17H,3-4,8H2,1-2H3,(H,13,14) |
| InChIKey | ISNGZMHBPKIOQD-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|