C17H27N2O3+ — CID 8818719
[2-(3,4-diethoxyanilino)-2-oxoethyl]-methyl-(2-methylprop-2-enyl)azanium (PubChem CID 8818719) has the molecular formula C17H27N2O3+ and a molecular weight of 307.41 g/mol. Its IUPAC name is [2-(3,4-diethoxyanilino)-2-oxoethyl]-methyl-(2-methylprop-2-enyl)azanium.
| Compound Name | [2-(3,4-diethoxyanilino)-2-oxoethyl]-methyl-(2-methylprop-2-enyl)azanium |
|---|---|
| PubChem CID | 8818719 |
| Molecular Formula | C17H27N2O3+ |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | [2-(3,4-diethoxyanilino)-2-oxoethyl]-methyl-(2-methylprop-2-enyl)azanium |
| SMILES | C=C(C)C[NH+](C)CC(=O)Nc1ccc(OCC)c(OCC)c1 |
| InChI | InChI=1S/C17H26N2O3/c1-6-21-15-9-8-14(10-16(15)22-7-2)18-17(20)12-19(5)11-13(3)4/h8-10H,3,6-7,11-12H2,1-2,4-5H3,(H,18,20)/p+1 |
| InChIKey | ULXKENGJNZJOBM-UHFFFAOYSA-O |
| XLogP | 1.51 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|