C16H24ClN2O3+ — CID 8818865
2-chloroprop-2-enyl-[2-(3,4-diethoxyanilino)-2-oxoethyl]-methylazanium (PubChem CID 8818865) has the molecular formula C16H24ClN2O3+ and a molecular weight of 327.83 g/mol. Its IUPAC name is 2-chloroprop-2-enyl-[2-(3,4-diethoxyanilino)-2-oxoethyl]-methylazanium.
| Compound Name | 2-chloroprop-2-enyl-[2-(3,4-diethoxyanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 8818865 |
| Molecular Formula | C16H24ClN2O3+ |
| Molecular Weight | 327.83 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 2-chloroprop-2-enyl-[2-(3,4-diethoxyanilino)-2-oxoethyl]-methylazanium |
| SMILES | C=C(Cl)C[NH+](C)CC(=O)Nc1ccc(OCC)c(OCC)c1 |
| InChI | InChI=1S/C16H23ClN2O3/c1-5-21-14-8-7-13(9-15(14)22-6-2)18-16(20)11-19(4)10-12(3)17/h7-9H,3,5-6,10-11H2,1-2,4H3,(H,18,20)/p+1 |
| InChIKey | KFGKBWXVKLALJY-UHFFFAOYSA-O |
| XLogP | 1.69 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.83 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |