C12H12Cl2FNO — CID 42910477
2,2-dichloro-N-(3-fluoro-4-methylphenyl)-1-methylcyclopropane-1-carboxamide (PubChem CID 42910477) has the molecular formula C12H12Cl2FNO and a molecular weight of 276.14 g/mol. Its IUPAC name is 2,2-dichloro-N-(3-fluoro-4-methylphenyl)-1-methylcyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-(3-fluoro-4-methylphenyl)-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 42910477 |
| Molecular Formula | C12H12Cl2FNO |
| Molecular Weight | 276.14 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | 2,2-dichloro-N-(3-fluoro-4-methylphenyl)-1-methylcyclopropane-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2(C)CC2(Cl)Cl)cc1F |
| InChI | InChI=1S/C12H12Cl2FNO/c1-7-3-4-8(5-9(7)15)16-10(17)11(2)6-12(11,13)14/h3-5H,6H2,1-2H3,(H,16,17) |
| InChIKey | XERHNHUEMSLNHL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.14 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|