C12H10Cl2F3NO — CID 17071382
2,2-dichloro-1-methyl-N-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide (PubChem CID 17071382) has the molecular formula C12H10Cl2F3NO and a molecular weight of 312.12 g/mol. Its IUPAC name is 2,2-dichloro-1-methyl-N-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-1-methyl-N-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 17071382 |
| Molecular Formula | C12H10Cl2F3NO |
| Molecular Weight | 312.12 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 2,2-dichloro-1-methyl-N-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide |
| SMILES | CC1(C(=O)Nc2ccc(C(F)(F)F)cc2)CC1(Cl)Cl |
| InChI | InChI=1S/C12H10Cl2F3NO/c1-10(6-11(10,13)14)9(19)18-8-4-2-7(3-5-8)12(15,16)17/h2-5H,6H2,1H3,(H,18,19) |
| InChIKey | MUPZWWUMQFWUJA-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.12 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|