C11H11Cl2NO — CID 16624359
2,2-dichloro-1-methyl-N-phenylcyclopropane-1-carboxamide (PubChem CID 16624359) has the molecular formula C11H11Cl2NO and a molecular weight of 244.12 g/mol. Its IUPAC name is 2,2-dichloro-1-methyl-N-phenylcyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-1-methyl-N-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 16624359 |
| Molecular Formula | C11H11Cl2NO |
| Molecular Weight | 244.12 g/mol |
| Exact Mass | 243.02 |
| IUPAC Name | 2,2-dichloro-1-methyl-N-phenylcyclopropane-1-carboxamide |
| SMILES | CC1(C(=O)Nc2ccccc2)CC1(Cl)Cl |
| InChI | InChI=1S/C11H11Cl2NO/c1-10(7-11(10,12)13)9(15)14-8-5-3-2-4-6-8/h2-6H,7H2,1H3,(H,14,15) |
| InChIKey | TZHYTOXMUPSNTR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.12 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|