C13H14Cl2N2O2S — CID 173422147
methyl 2,2-dichloro-1-methyl-N-(phenylcarbamoyloxy)cyclopropane-1-carboximidothioate (PubChem CID 173422147) has the molecular formula C13H14Cl2N2O2S and a molecular weight of 333.24 g/mol. Its IUPAC name is methyl 2,2-dichloro-1-methyl-N-(phenylcarbamoyloxy)cyclopropane-1-carboximidothioate.
| Compound Name | methyl 2,2-dichloro-1-methyl-N-(phenylcarbamoyloxy)cyclopropane-1-carboximidothioate |
|---|---|
| PubChem CID | 173422147 |
| Molecular Formula | C13H14Cl2N2O2S |
| Molecular Weight | 333.24 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | methyl 2,2-dichloro-1-methyl-N-(phenylcarbamoyloxy)cyclopropane-1-carboximidothioate |
| SMILES | CSC(=NOC(=O)Nc1ccccc1)C1(C)CC1(Cl)Cl |
| InChI | InChI=1S/C13H14Cl2N2O2S/c1-12(8-13(12,14)15)10(20-2)17-19-11(18)16-9-6-4-3-5-7-9/h3-7H,8H2,1-2H3,(H,16,18) |
| InChIKey | TXNGJXYODPVBMR-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.24 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|