C10H9Cl2NO — CID 7946169
(1S)-2,2-dichloro-N-phenylcyclopropane-1-carboxamide (PubChem CID 7946169) has the molecular formula C10H9Cl2NO and a molecular weight of 230.09 g/mol. Its IUPAC name is (1S)-2,2-dichloro-N-phenylcyclopropane-1-carboxamide.
| Compound Name | (1S)-2,2-dichloro-N-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 7946169 |
| Molecular Formula | C10H9Cl2NO |
| Molecular Weight | 230.09 g/mol |
| Exact Mass | 229.01 |
| IUPAC Name | (1S)-2,2-dichloro-N-phenylcyclopropane-1-carboxamide |
| SMILES | O=C(Nc1ccccc1)[C@@H]1CC1(Cl)Cl |
| InChI | InChI=1S/C10H9Cl2NO/c11-10(12)6-8(10)9(14)13-7-4-2-1-3-5-7/h1-5,8H,6H2,(H,13,14)/t8-/m0/s1 |
| InChIKey | JEADSZHGHPYUPN-QMMMGPOBSA-N |
| XLogP | 2.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.09 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|