C13H15NO3 — CID 929902
(3S)-2,2-dimethyl-5-oxo-N-phenyloxolane-3-carboxamide (PubChem CID 929902) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is (3S)-2,2-dimethyl-5-oxo-N-phenyloxolane-3-carboxamide.
| Compound Name | (3S)-2,2-dimethyl-5-oxo-N-phenyloxolane-3-carboxamide |
|---|---|
| PubChem CID | 929902 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | (3S)-2,2-dimethyl-5-oxo-N-phenyloxolane-3-carboxamide |
| SMILES | CC1(C)OC(=O)C[C@@H]1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C13H15NO3/c1-13(2)10(8-11(15)17-13)12(16)14-9-6-4-3-5-7-9/h3-7,10H,8H2,1-2H3,(H,14,16)/t10-/m1/s1 |
| InChIKey | ZYKOBPVQPYYISF-SNVBAGLBSA-N |
| XLogP | 1.97 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |