C7H9O4- — CID 6931352
(3R)-2,2-dimethyl-5-oxooxolane-3-carboxylate (PubChem CID 6931352) has the molecular formula C7H9O4- and a molecular weight of 157.14 g/mol. Its IUPAC name is (3R)-2,2-dimethyl-5-oxooxolane-3-carboxylate.
| Compound Name | (3R)-2,2-dimethyl-5-oxooxolane-3-carboxylate |
|---|---|
| PubChem CID | 6931352 |
| Molecular Formula | C7H9O4- |
| Molecular Weight | 157.14 g/mol |
| Exact Mass | 157.05 |
| IUPAC Name | (3R)-2,2-dimethyl-5-oxooxolane-3-carboxylate |
| SMILES | CC1(C)OC(=O)C[C@H]1C(=O)[O-] |
| InChI | InChI=1S/C7H10O4/c1-7(2)4(6(9)10)3-5(8)11-7/h4H,3H2,1-2H3,(H,9,10)/p-1/t4-/m0/s1 |
| InChIKey | UZBOWOQARWWIER-BYPYZUCNSA-M |
| XLogP | -0.92 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.14 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |