About (4R)-5,5-dimethyl-4-[(2S)-2-pyridin-2-ylpiperidine-1-carbonyl]oxolan-2-one
(4R)-5,5-dimethyl-4-[(2S)-2-pyridin-2-ylpiperidine-1-carbonyl]oxolan-2-one (PubChem CID 100819553) has the molecular formula C17H22N2O3
and a molecular weight of 302.37 g/mol. Its IUPAC name is (4R)-5,5-dimethyl-4-[(2S)-2-pyridin-2-ylpiperidine-1-carbonyl]oxolan-2-one.
Molecular Properties
| Compound Name | (4R)-5,5-dimethyl-4-[(2S)-2-pyridin-2-ylpiperidine-1-carbonyl]oxolan-2-one |
| PubChem CID | 100819553 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | (4R)-5,5-dimethyl-4-[(2S)-2-pyridin-2-ylpiperidine-1-carbonyl]oxolan-2-one |
| SMILES | CC1(C)OC(=O)C[C@H]1C(=O)N1CCCC[C@H]1c1ccccn1 |
| InChI | InChI=1S/C17H22N2O3/c1-17(2)12(11-15(20)22-17)16(21)19-10-6-4-8-14(19)13-7-3-5-9-18-13/h3,5,7,9,12,14H,4,6,8,10-11H2,1-2H3/t12-,14-/m0/s1 |
| InChIKey | KIYDVIICZYIHNT-JSGCOSHPSA-N |
| XLogP | 2.48 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4R)-5,5-dimethyl-4-[(2S)-2-pyridin-2-ylpiperidine-1-carbonyl]oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-5,5-dimethyl-4-[(2S)-2-pyridin-2-ylpiperidine-1-carbonyl]oxolan-2-one?
The IUPAC name of (4R)-5,5-dimethyl-4-[(2S)-2-pyridin-2-ylpiperidine-1-carbonyl]oxolan-2-one (CID 100819553) is (4R)-5,5-dimethyl-4-[(2S)-2-pyridin-2-ylpiperidine-1-carbonyl]oxolan-2-one.
What is the SMILES notation for (4R)-5,5-dimethyl-4-[(2S)-2-pyridin-2-ylpiperidine-1-carbonyl]oxolan-2-one?
The canonical SMILES for (4R)-5,5-dimethyl-4-[(2S)-2-pyridin-2-ylpiperidine-1-carbonyl]oxolan-2-one is CC1(C)OC(=O)C[C@H]1C(=O)N1CCCC[C@H]1c1ccccn1.
What is the InChIKey of (4R)-5,5-dimethyl-4-[(2S)-2-pyridin-2-ylpiperidine-1-carbonyl]oxolan-2-one?
The InChIKey is KIYDVIICZYIHNT-JSGCOSHPSA-N. The full InChI is InChI=1S/C17H22N2O3/c1-17(2)12(11-15(20)22-17)16(21)19-10-6-4-8-14(19)13-7-3-5-9-18-13/h3,5,7,9,12,14H,4,6,8,10-11H2,1-2H3/t12-,14-/m0/s1.
What are the key properties of (4R)-5,5-dimethyl-4-[(2S)-2-pyridin-2-ylpiperidine-1-carbonyl]oxolan-2-one?
(4R)-5,5-dimethyl-4-[(2S)-2-pyridin-2-ylpiperidine-1-carbonyl]oxolan-2-one has a molecular weight of 302.37 g/mol, XLogP of 2.48, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-5,5-dimethyl-4-[(2S)-2-pyridin-2-ylpiperidine-1-carbonyl]oxolan-2-one is sourced from PubChem (CID 100819553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).