C14H16ClN5O — CID 77084225
(3-amino-4-chloro-1H-pyrazol-5-yl)-(2-pyridin-2-ylpiperidin-1-yl)methanone (PubChem CID 77084225) has the molecular formula C14H16ClN5O and a molecular weight of 305.77 g/mol. Its IUPAC name is (3-amino-4-chloro-1H-pyrazol-5-yl)-(2-pyridin-2-ylpiperidin-1-yl)methanone.
| Compound Name | (3-amino-4-chloro-1H-pyrazol-5-yl)-(2-pyridin-2-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 77084225 |
| Molecular Formula | C14H16ClN5O |
| Molecular Weight | 305.77 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | (3-amino-4-chloro-1H-pyrazol-5-yl)-(2-pyridin-2-ylpiperidin-1-yl)methanone |
| SMILES | Nc1n[nH]c(C(=O)N2CCCCC2c2ccccn2)c1Cl |
| InChI | InChI=1S/C14H16ClN5O/c15-11-12(18-19-13(11)16)14(21)20-8-4-2-6-10(20)9-5-1-3-7-17-9/h1,3,5,7,10H,2,4,6,8H2,(H3,16,18,19) |
| InChIKey | VBSFXXKVHJBAEM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.77 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |