C19H18N4O2 — CID 99953113
4-[(2S)-2-pyridin-2-ylpiperidine-1-carbonyl]-2H-phthalazin-1-one (PubChem CID 99953113) has the molecular formula C19H18N4O2 and a molecular weight of 334.38 g/mol. Its IUPAC name is 4-[(2S)-2-pyridin-2-ylpiperidine-1-carbonyl]-2H-phthalazin-1-one.
| Compound Name | 4-[(2S)-2-pyridin-2-ylpiperidine-1-carbonyl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 99953113 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 4-[(2S)-2-pyridin-2-ylpiperidine-1-carbonyl]-2H-phthalazin-1-one |
| SMILES | O=C(c1n[nH]c(=O)c2ccccc12)N1CCCC[C@H]1c1ccccn1 |
| InChI | InChI=1S/C19H18N4O2/c24-18-14-8-2-1-7-13(14)17(21-22-18)19(25)23-12-6-4-10-16(23)15-9-3-5-11-20-15/h1-3,5,7-9,11,16H,4,6,10,12H2,(H,22,24)/t16-/m0/s1 |
| InChIKey | IFTIIDJIOGQOJK-INIZCTEOSA-N |
| XLogP | 2.69 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |